CAS 1803608-84-5

Pyridine, 3-bromo-5-(3-pyrrolidinyloxy)-, hydrochloride (1:2)

Description:

Pyridine, 3-bromo-5-(3-pyrrolidinyloxy)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine substituent at the 3-position and a pyrrolidinyloxy group at the 5-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit properties such as being a potential ligand or a building block in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. Its molecular interactions are influenced by the electron-withdrawing nature of the bromine atom and the electron-donating characteristics of the pyrrolidinyloxy group, which can affect its pharmacokinetic and pharmacodynamic profiles. Safety and handling precautions should be observed due to the presence of bromine and the potential biological activity of the compound.

Formula: C₉H₁₁BrN₂O·2ClH

InChI: InChI=1S/C9H11BrN2O.2ClH/c10-7-3-9(6-12-4-7)13-8-1-2-11-5-8;;/h3-4,6,8,11H,1-2,5H2;2*1H

InChI key: InChIKey=QJBWFOROEMWRCY-UHFFFAOYSA-N

SMILES: O(C=1C=C(Br)C=NC1)C2CCNC2.Cl

Synonyms:

• Pyridine, 3-bromo-5-(3-pyrrolidinyloxy)-, hydrochloride (1:2)

3-Bromo-5-(pyrrolidin-3-yloxy)pyridine dihydrochloride

CAS: 1803608-84-5

Versatile small molecule scaffold

Formula: C₉H₁₃BrCl₂N₂O

Purity: Min. 95%

Molecular weight: 316.02 g/mol

Ref: 3D-DXC60884