CAS 1803609-02-0

Azetidine, 2-cyclopropyl-3,3-dimethyl-, hydrochloride (1:1)

Description:

Azetidine, 2-cyclopropyl-3,3-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of cyclopropyl and dimethyl substituents contributes to its unique properties, influencing its steric and electronic characteristics. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in various fields, including pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry for drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to therapeutic effects. However, specific details regarding its reactivity, stability, and biological activity would require further investigation through experimental studies. Overall, azetidine derivatives are known for their diverse applications, and this particular compound may offer unique advantages due to its structural features.

Formula: C₈H₁₅N·ClH

InChI: InChI=1S/C8H15N.ClH/c1-8(2)5-9-7(8)6-3-4-6;/h6-7,9H,3-5H2,1-2H3;1H

InChI key: InChIKey=HIIGRPUBOAXFDC-UHFFFAOYSA-N

SMILES: CC1(C)C(NC1)C2CC2.Cl

Synonyms:

• Azetidine, 2-cyclopropyl-3,3-dimethyl-, hydrochloride (1:1)

2-Cyclopropyl-3,3-dimethylazetidine hydrochloride

CAS: 1803609-02-0

Versatile small molecule scaffold

Formula: C₈H₁₆ClN

Purity: Min. 95%

Molecular weight: 161.67 g/mol

Ref: 3D-DXC60902