CAS 1803609-60-0

3H-Imidazo[4,5-c]pyridine, 2-cyclohexyl-4,5,6,7-tetrahydro-, hydrochloride (1:2)

Description:

3H-Imidazo[4,5-c]pyridine, 2-cyclohexyl-4,5,6,7-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which incorporates both imidazole and pyridine rings. This compound features a cyclohexyl group that enhances its hydrophobic properties, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. The presence of the tetrahydro moiety indicates that the compound has undergone partial hydrogenation, which can affect its reactivity and interaction with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions, mechanisms of action, and potential applications would require further investigation through experimental studies. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₂H₁₉N₃·2ClH

InChI: InChI=1S/C12H19N3.2ClH/c1-2-4-9(5-3-1)12-14-10-6-7-13-8-11(10)15-12;;/h9,13H,1-8H2,(H,14,15);2*1H

InChI key: InChIKey=ZLWXWIPRTZCGGT-UHFFFAOYSA-N

SMILES: C=1(NC2=C(N1)CNCC2)C3CCCCC3.Cl

Synonyms:

• 3H-Imidazo[4,5-c]pyridine, 2-cyclohexyl-4,5,6,7-tetrahydro-, hydrochloride (1:2)

2-Cyclohexyl-1H,4H,5H,6H,7H-imidazo[4,5-c]pyridine dihydrochloride

CAS: 1803609-60-0

Versatile small molecule scaffold

Formula: C₁₂H₂₁Cl₂N₃

Purity: Min. 95%

Molecular weight: 278.22 g/mol

Ref: 3D-DXC60960