CAS 1803609-77-9

Benzenemethanamine, α-methyl-4-(2H-tetrazol-5-yl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, α-methyl-4-(2H-tetrazol-5-yl)-, hydrochloride (1:1), with the CAS number 1803609-77-9, is a chemical compound characterized by its unique structure that includes a benzenemethanamine backbone substituted with an α-methyl group and a 2H-tetrazole moiety. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and other polar solvents. The presence of the tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their role in medicinal chemistry, often exhibiting properties such as antimicrobial or anti-inflammatory effects. The compound's molecular structure suggests it may interact with various biological targets, making it of interest in pharmaceutical research. Additionally, the hydrochloride form indicates that it is likely to be stable under standard laboratory conditions, although specific handling and storage recommendations should be followed to maintain its integrity. Overall, this compound represents a class of substances that may have significant implications in drug development and therapeutic applications.

Formula: C₉H₁₁N₅·ClH

InChI: InChI=1S/C9H11N5.ClH/c1-6(10)7-2-4-8(5-3-7)9-11-13-14-12-9;/h2-6H,10H2,1H3,(H,11,12,13,14);1H

InChI key: InChIKey=JWCITYJEMFRYAD-UHFFFAOYSA-N

SMILES: C(C)(N)C1=CC=C(C=C1)C=2NN=NN2.Cl

Synonyms:

• Benzenemethanamine, α-methyl-4-(2H-tetrazol-5-yl)-, hydrochloride (1:1)

1-[4-(2H-1,2,3,4-Tetrazol-5-yl)phenyl]ethan-1-amine hydrochloride

CAS: 1803609-77-9

Versatile small molecule scaffold

Formula: C₉H₁₂ClN₅

Purity: Min. 95%

Molecular weight: 225.68 g/mol

Ref: 3D-DXC60977