CAS 1803610-00-5

Ethyl 1-methyl-3-(4-pyridinyl)-1H-1,2,4-triazole-5-carboxylate

Description:

Ethyl 1-methyl-3-(4-pyridinyl)-1H-1,2,4-triazole-5-carboxylate is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a pyridine ring enhances its potential for biological activity, as pyridine derivatives are often associated with various pharmacological properties. The methyl group at the 1-position of the triazole ring and the carboxylate group at the 5-position further influence its chemical behavior and interactions. This compound may exhibit properties such as antimicrobial, antifungal, or herbicidal activities, making it of interest in agricultural and pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.

Formula: C₁₁H₁₂N₄O₂

InChI: InChI=1S/C11H12N4O2/c1-3-17-11(16)10-13-9(14-15(10)2)8-4-6-12-7-5-8/h4-7H,3H2,1-2H3

InChI key: InChIKey=DGIVXQGDDLOVEY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=NC(=NN1C)C=2C=CN=CC2

Synonyms:

• 1H-1,2,4-Triazole-5-carboxylic acid, 1-methyl-3-(4-pyridinyl)-, ethyl ester
• Ethyl 1-methyl-3-(4-pyridinyl)-1H-1,2,4-triazole-5-carboxylate

Ethyl 1-methyl-3-(pyridin-4-yl)-1H-1,2,4-triazole-5-carboxylate

CAS: 1803610-00-5

Versatile small molecule scaffold

Formula: C₁₁H₁₂N₄O₂

Purity: Min. 95%

Molecular weight: 232.24 g/mol

Ref: 3D-DXC61000