CAS 1803610-25-4

1H-1,2,4-Triazol-5-amine, 1-(4-pyridinyl)-, hydrochloride (1:1)

Description:

1H-1,2,4-Triazol-5-amine, 1-(4-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its triazole and pyridine functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is indicative of its polar nature due to the presence of the amine and hydrochloride moieties. This compound is often studied for its potential biological activities, including antimicrobial and antifungal properties, owing to the triazole ring, which is known for its ability to interact with biological targets. The hydrochloride form enhances its stability and solubility, making it suitable for pharmaceutical applications. Additionally, the presence of the pyridine ring may contribute to its lipophilicity and influence its interaction with biological systems. As with many nitrogen-containing heterocycles, it may also exhibit interesting coordination chemistry with metal ions, which can be relevant in various fields, including medicinal chemistry and materials science.

Formula: C₇H₇N₅·ClH

InChI: InChI=1S/C7H7N5.ClH/c8-7-10-5-11-12(7)6-1-3-9-4-2-6;/h1-5H,(H2,8,10,11);1H

InChI key: InChIKey=GPTYUSYFXROCCY-UHFFFAOYSA-N

SMILES: NC=1N(N=CN1)C=2C=CN=CC2.Cl

Synonyms:

• 1H-1,2,4-Triazol-5-amine, 1-(4-pyridinyl)-, hydrochloride (1:1)

1-(Pyridin-4-yl)-1H-1,2,4-triazol-5-amine hydrochloride

CAS: 1803610-25-4

Versatile small molecule scaffold

Formula: C₇H₈ClN₅

Purity: Min. 95%

Molecular weight: 197.62 g/mol

Ref: 3D-DXC61025