CAS 1803610-48-1

3H-Pyrazol-3-one, 5-(aminomethyl)-2,4-dihydro-2-methyl-, hydrochloride (1:2)

Description:

3H-Pyrazol-3-one, 5-(aminomethyl)-2,4-dihydro-2-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazolone structure, which features a five-membered ring containing two nitrogen atoms. This compound typically exhibits properties associated with both pyrazolones and amines, including potential biological activity. The presence of the aminomethyl group suggests it may participate in various chemical reactions, including nucleophilic substitutions. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical applications. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure contributes to its reactivity and interaction with biological targets, which can be explored further in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₅H₉N₃O·2ClH

InChI: InChI=1S/C5H9N3O.2ClH/c1-8-5(9)2-4(3-6)7-8;;/h2-3,6H2,1H3;2*1H

InChI key: InChIKey=XCXLGGCJOGUBSF-UHFFFAOYSA-N

SMILES: C(N)C=1CC(=O)N(C)N1.Cl

Synonyms:

• 3H-Pyrazol-3-one, 5-(aminomethyl)-2,4-dihydro-2-methyl-, hydrochloride (1:2)

3-(Aminomethyl)-1-methyl-4,5-dihydro-1H-pyrazol-5-one dihydrochloride

CAS: 1803610-48-1

Versatile small molecule scaffold

Formula: C₅H₁₁Cl₂N₃O

Purity: Min. 95%

Molecular weight: 200.06 g/mol

Ref: 3D-DXC61048