CAS 1803610-49-2

1-(Difluoromethoxy)-2,5-difluoro-4-nitrobenzene

Description:

1-(Difluoromethoxy)-2,5-difluoro-4-nitrobenzene is an organic compound characterized by its unique molecular structure, which includes a nitro group and multiple fluorine substituents on a benzene ring. The presence of the difluoromethoxy group introduces significant polarity and influences the compound's reactivity and solubility. This compound is likely to exhibit properties typical of halogenated aromatic compounds, such as increased stability and potential for electrophilic substitution reactions. The nitro group, being a strong electron-withdrawing group, can further enhance the reactivity of the aromatic system. Additionally, the fluorine atoms contribute to the compound's lipophilicity and may affect its interaction with biological systems, making it of interest in pharmaceutical and agrochemical research. The compound's CAS number, 1803610-49-2, allows for easy identification in chemical databases, facilitating research and application in various fields, including materials science and medicinal chemistry. Overall, this compound's unique characteristics make it a subject of interest for further study and potential applications.

Formula: C₇H₃F₄NO₃

InChI: InChI=1S/C7H3F4NO3/c8-3-2-6(15-7(10)11)4(9)1-5(3)12(13)14/h1-2,7H

InChI key: InChIKey=VITIKGAJQMJZFF-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=C(F)C=C(N(=O)=O)C(F)=C1

Synonyms:

• Benzene, 1-(difluoromethoxy)-2,5-difluoro-4-nitro-
• 1-(Difluoromethoxy)-2,5-difluoro-4-nitrobenzene

1-(Difluoromethoxy)-2,5-difluoro-4-nitrobenzene

CAS: 1803610-49-2

Versatile small molecule scaffold

Formula: C₇H₃F₄NO₃

Purity: Min. 95%

Molecular weight: 225.1 g/mol

Ref: 3D-DXC61049