CAS 1803610-69-6

1-(1,1-Dimethylethyl) 3-(4-carboxy-1H-pyrazol-3-yl)-1-piperidinecarboxylate

Description:

1-(1,1-Dimethylethyl) 3-(4-carboxy-1H-pyrazol-3-yl)-1-piperidinecarboxylate, with CAS number 1803610-69-6, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a carboxylic acid group, and a pyrazole moiety. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its steric bulk, potentially influencing its reactivity and solubility. This compound may exhibit properties typical of piperidine derivatives, such as potential biological activity, making it of interest in medicinal chemistry. The carboxylic acid functionality can participate in various chemical reactions, including esterification and amidation, while the pyrazole ring may impart specific pharmacological properties. Overall, the unique combination of functional groups in this compound suggests potential applications in drug development or as a biochemical probe, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₄H₂₁N₃O₄

InChI: InChI=1S/C14H21N3O4/c1-14(2,3)21-13(20)17-6-4-5-9(8-17)11-10(12(18)19)7-15-16-11/h7,9H,4-6,8H2,1-3H3,(H,15,16)(H,18,19)

InChI key: InChIKey=VGSGJTQWUGFETH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=NNC1)C2CN(C(OC(C)(C)C)=O)CCC2

Synonyms:

• 1-(1,1-Dimethylethyl) 3-(4-carboxy-1H-pyrazol-3-yl)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-(4-carboxy-1H-pyrazol-3-yl)-, 1-(1,1-dimethylethyl) ester

3-{1-[(tert-Butoxy)carbonyl]piperidin-3-yl}-1H-pyrazole-4-carboxylic acid

CAS: 1803610-69-6

Versatile small molecule scaffold

Formula: C₁₄H₂₁N₃O₄

Purity: Min. 95%

Molecular weight: 295.33 g/mol

Ref: 3D-DXC61069