CAS 1803610-95-8

Azetidine, 3-(4-nitrophenoxy)-, hydrochloride (1:1)

Description:

Azetidine, 3-(4-nitrophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 4-nitrophenoxy group indicates that the compound has a nitrophenyl moiety attached to the azetidine, contributing to its chemical reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-inflammatory effects, depending on its specific interactions within biological systems. Its molecular structure allows for potential interactions with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many nitro-containing compounds, due to potential toxicity and environmental concerns.

Formula: C₉H₁₀N₂O₃·ClH

InChI: InChI=1S/C9H10N2O3.ClH/c12-11(13)7-1-3-8(4-2-7)14-9-5-10-6-9;/h1-4,9-10H,5-6H2;1H

InChI key: InChIKey=MLVOMRFYSHTTCK-UHFFFAOYSA-N

SMILES: O(C1=CC=C(N(=O)=O)C=C1)C2CNC2.Cl

Synonyms:

• Azetidine, 3-(4-nitrophenoxy)-, hydrochloride (1:1)

3-(4-Nitrophenoxy)azetidine hydrochloride

CAS: 1803610-95-8

Versatile small molecule scaffold

Formula: C₉H₁₁ClN₂O₃

Purity: Min. 95%

Molecular weight: 230.65 g/mol

Ref: 3D-DXC61095