CAS 1803611-55-3

1-(Azidomethyl)-3-(methylsulfonyl)-5-(trifluoromethyl)benzene

Description:

1-(Azidomethyl)-3-(methylsulfonyl)-5-(trifluoromethyl)benzene, identified by its CAS number 1803611-55-3, is a synthetic organic compound characterized by the presence of an azide group, a methylsulfonyl group, and a trifluoromethyl group attached to a benzene ring. The azide functional group (-N3) is known for its reactivity, particularly in click chemistry and as a precursor for various nitrogen-containing compounds. The methylsulfonyl group (-SO2CH3) contributes to the compound's polar characteristics and can enhance solubility in polar solvents, while the trifluoromethyl group (-CF3) is known for imparting unique electronic properties and increasing lipophilicity. This compound may exhibit interesting biological activities and could be utilized in medicinal chemistry or materials science. Its stability and reactivity profile would depend on the specific conditions under which it is handled, including temperature and the presence of other reactive species. As with many azide-containing compounds, caution is advised due to potential explosive decomposition under certain conditions.

Formula: C₉H₈F₃N₃O₂S

InChI: InChI=1S/C9H8F3N3O2S/c1-18(16,17)8-3-6(5-14-15-13)2-7(4-8)9(10,11)12/h2-4H,5H2,1H3

InChI key: InChIKey=GHYPDWKBDTYUBQ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(S(C)(=O)=O)=CC(CN=[N+]=[N-])=C1

Synonyms:

• Benzene, 1-(azidomethyl)-3-(methylsulfonyl)-5-(trifluoromethyl)-
• 1-(Azidomethyl)-3-(methylsulfonyl)-5-(trifluoromethyl)benzene

1-(Azidomethyl)-3-methanesulfonyl-5-(trifluoromethyl)benzene

CAS: 1803611-55-3

Versatile small molecule scaffold

Formula: C₉H₈F₃N₃O₂S

Purity: Min. 95%

Molecular weight: 279.24 g/mol

Ref: 3D-DXC61155