CymitQuimica logo

CAS 1803611-79-1

:

N-[(5,6,7,8-Tetrahydroimidazo[1,2-a]pyridin-6-yl)methyl]methanesulfonamide

Description:
N-[(5,6,7,8-Tetrahydroimidazo[1,2-a]pyridin-6-yl)methyl]methanesulfonamide is a chemical compound characterized by its unique structure, which includes a tetrahydroimidazo[1,2-a]pyridine moiety linked to a methanesulfonamide group. This compound typically exhibits properties associated with both the imidazo and sulfonamide functional groups, such as potential biological activity and solubility in polar solvents. The presence of the tetrahydroimidazo ring suggests it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which can influence its reactivity and interaction with biological targets. Additionally, the methanesulfonamide portion may contribute to its pharmacological properties, as sulfonamides are known for their antimicrobial and diuretic effects. The compound's molecular weight, melting point, and specific solubility characteristics would depend on its precise formulation and purity. Overall, this substance may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C9H15N3O2S
InChI:InChI=1S/C9H15N3O2S/c1-15(13,14)11-6-8-2-3-9-10-4-5-12(9)7-8/h4-5,8,11H,2-3,6-7H2,1H3
InChI key:InChIKey=VOLPKFICVOQDJN-UHFFFAOYSA-N
SMILES:C(NS(C)(=O)=O)C1CN2C(CC1)=NC=C2
Synonyms:
  • N-[(5,6,7,8-Tetrahydroimidazo[1,2-a]pyridin-6-yl)methyl]methanesulfonamide
  • Methanesulfonamide, N-[(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.