CAS 1803611-94-0

1H-Inden-1-amine, 5-fluoro-2,3-dihydro-6-methoxy-, hydrochloride (1:1)

Description:

1H-Inden-1-amine, 5-fluoro-2,3-dihydro-6-methoxy-, hydrochloride (1:1), with the CAS number 1803611-94-0, is a chemical compound characterized by its unique bicyclic structure, which includes an indene moiety. This compound features a fluorine atom at the 5-position and a methoxy group at the 6-position, contributing to its potential biological activity. The presence of the amine functional group suggests that it may exhibit basic properties, while the hydrochloride form indicates that it is a salt, enhancing its solubility in water. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its interaction with biological targets. Additionally, the dihydro form implies that it has undergone partial hydrogenation, affecting its reactivity and stability. Overall, the characteristics of this compound suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation.

Formula: C₁₀H₁₂FNO·ClH

InChI: InChI=1S/C10H12FNO.ClH/c1-13-10-5-7-6(4-8(10)11)2-3-9(7)12;/h4-5,9H,2-3,12H2,1H3;1H

InChI key: InChIKey=SEGPKRGBJLIKKP-UHFFFAOYSA-N

SMILES: NC1C=2C(=CC(F)=C(OC)C2)CC1.Cl

Synonyms:

• 1H-Inden-1-amine, 5-fluoro-2,3-dihydro-6-methoxy-, hydrochloride (1:1)

5-Fluoro-6-methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride

Controlled Product

CAS: 1803611-94-0

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClFNO

Purity: Min. 95%

Molecular weight: 217.67 g/mol

Ref: 3D-DXC61194