CAS 1803611-95-1

4-Pyrimidineacetic acid, 5-bromo-, sodium salt (1:1)

Description:

4-Pyrimidineacetic acid, 5-bromo-, sodium salt (1:1) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a bromine substituent at the 5-position of the pyrimidine ring, which can influence its reactivity and biological activity. As a sodium salt, it is typically more soluble in water compared to its acid form, making it useful in various applications, including pharmaceuticals and biochemistry. The presence of the sodium ion enhances its stability and solubility, facilitating its use in aqueous environments. This compound may exhibit biological activity, potentially acting as an intermediate in the synthesis of other chemical entities or as a ligand in biochemical assays. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied or utilized.

Formula: C₆H₅BrN₂O₂·Na

InChI: InChI=1S/C6H5BrN2O2.Na/c7-4-2-8-3-9-5(4)1-6(10)11;/h2-3H,1H2,(H,10,11);

InChI key: InChIKey=XXNOIEVALZRDBI-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C(Br)=CN=CN1.[Na]

Synonyms:

• 4-Pyrimidineacetic acid, 5-bromo-, sodium salt (1:1)

Sodium 2-(5-bromopyrimidin-4-yl)acetate

CAS: 1803611-95-1

Versatile small molecule scaffold

Formula: C₆H₄BrN₂NaO₂

Purity: Min. 95%

Molecular weight: 239 g/mol

Ref: 3D-DXC61195