CAS 1803612-01-2

2-Furancarboxylic acid, 3-[(dimethylamino)methyl]-, hydrochloride (1:1)

Description:

2-Furancarboxylic acid, 3-[(dimethylamino)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a carboxylic acid functional group and a dimethylamino group, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. The presence of the dimethylamino group suggests possible basic properties, which may influence its reactivity and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure allows for potential applications in drug development, particularly in the design of compounds with specific pharmacological properties. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the hydrochloride salt.

Formula: C₈H₁₁NO₃·ClH

InChI: InChI=1S/C8H11NO3.ClH/c1-9(2)5-6-3-4-12-7(6)8(10)11;/h3-4H,5H2,1-2H3,(H,10,11);1H

InChI key: InChIKey=KFLPFGNRVLQXDO-UHFFFAOYSA-N

SMILES: C(N(C)C)C1=C(C(O)=O)OC=C1.Cl

Synonyms:

• 2-Furancarboxylic acid, 3-[(dimethylamino)methyl]-, hydrochloride (1:1)

3-[(Dimethylamino)methyl]furan-2-carboxylic acid hydrochloride

CAS: 1803612-01-2

Versatile small molecule scaffold

Formula: C₈H₁₂ClNO₃

Purity: Min. 95%

Molecular weight: 205.64 g/mol

Ref: 3D-DXC61201