CAS 1803612-14-7

Phenol, 2-(aminomethyl)-4-bromo-, hydrochloride (1:1)

Description:

Phenol, 2-(aminomethyl)-4-bromo-, hydrochloride (1:1) is a chemical compound characterized by its phenolic structure, which includes a bromine substituent and an aminomethyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The bromine atom introduces electrophilic properties, making it reactive in various chemical reactions, while the aminomethyl group can participate in hydrogen bonding and nucleophilic interactions. The hydrochloride form enhances its stability and solubility in aqueous solutions, making it useful in various applications, including pharmaceuticals and organic synthesis. Safety considerations include handling it with care, as it may pose health risks upon exposure. Overall, this compound's unique functional groups contribute to its reactivity and potential utility in synthetic chemistry and medicinal applications.

Formula: C₇H₈BrNO·ClH

InChI: InChI=1S/C7H8BrNO.ClH/c8-6-1-2-7(10)5(3-6)4-9;/h1-3,10H,4,9H2;1H

InChI key: InChIKey=OKFKBSXEQHOIQQ-UHFFFAOYSA-N

SMILES: C(N)C1=C(O)C=CC(Br)=C1.Cl

Synonyms:

• Phenol, 2-(aminomethyl)-4-bromo-, hydrochloride (1:1)

2-(Aminomethyl)-4-Bromophenol Hydrochloride

CAS: 1803612-14-7

Formula: C₇H₉BrClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 238.5095

Ref: IN-DA01BA92

2-(Aminomethyl)-4-bromophenol hydrochloride

CAS: 1803612-14-7

2-(Aminomethyl)-4-bromophenol hydrochloride

Purity: 95%

Molecular weight: 238.51g/mol

Ref: 54-OR77025

2-(Aminomethyl)-4-bromophenol Hydrochloride

CAS: 1803612-14-7

Formula: C₇H₉BrClNO

Purity: 95%

Color and Shape: No data available.

Molecular weight: 238.51

Ref: 10-F093680