CAS 1803612-15-8

2-Pyridinecarboxylic acid, 5-amino-3-chloro-, methyl ester, hydrochloride (1:1)

Description:

2-Pyridinecarboxylic acid, 5-amino-3-chloro-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid group and an amino group, contributing to its potential as a biologically active molecule. The presence of a chlorine atom at the 3-position of the pyridine ring adds to its reactivity and may influence its pharmacological properties. As a methyl ester, it indicates that the carboxylic acid is esterified with methanol, which can enhance its lipophilicity and bioavailability. The hydrochloride form suggests that the compound is a salt, which typically improves solubility in water and stability. This compound may be of interest in medicinal chemistry and drug development due to its structural features that could interact with biological targets. Its specific applications and effects would depend on further studies and characterization, including its synthesis, biological activity, and potential therapeutic uses.

Formula: C₇H₇ClN₂O₂·ClH

InChI: InChI=1S/C7H7ClN2O2.ClH/c1-12-7(11)6-5(8)2-4(9)3-10-6;/h2-3H,9H2,1H3;1H

InChI key: InChIKey=JNAVNTLIVGRCLM-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(Cl)C=C(N)C=N1.Cl

Synonyms:

• 2-Pyridinecarboxylic acid, 5-amino-3-chloro-, methyl ester, hydrochloride (1:1)

Methyl 5-amino-3-chloropyridine-2-carboxylate hydrochloride

CAS: 1803612-15-8

Versatile small molecule scaffold

Formula: C₇H₈Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 223.05 g/mol

Ref: 3D-DXC61215