CAS 18038-55-6
:Bis(trichlorosilyl)acetylene
Description:
Bis(trichlorosilyl)acetylene, with the CAS number 18038-55-6, is an organosilicon compound characterized by its unique structure, which features two trichlorosilyl groups attached to an acetylene backbone. This compound is typically a colorless to pale yellow liquid and is known for its high reactivity due to the presence of multiple silicon-chlorine bonds. It is used in various applications, including as a precursor in the synthesis of silicon-containing polymers and materials. The presence of trichlorosilyl groups imparts significant reactivity, making it useful in chemical reactions that involve the formation of siloxane bonds. Additionally, Bis(trichlorosilyl)acetylene can undergo hydrolysis, leading to the formation of silanol compounds, which can further react to form siloxane networks. Due to its chlorinated nature, it is important to handle this compound with care, as it can release hydrochloric acid upon reaction with moisture. Overall, its unique properties make it a valuable compound in the field of materials science and organosilicon chemistry.
Formula:C2Cl6Si2
InChI:InChI=1/C2Cl6Si2/c3-9(4,5)1-2-10(6,7)8
SMILES:C(#C[Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl
Synonyms:- Ethyne-1,2-Diylbis(Trichlorosilane)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
