CAS 18046-41-8

1H-Benzimidazole-2-ethanol,5-methyl-(9CI)

Description:

1H-Benzimidazole-2-ethanol, 5-methyl- (CAS 18046-41-8) is an organic compound characterized by its benzimidazole core, which is a bicyclic structure consisting of a fused benzene and imidazole ring. This compound features a hydroxyl group (-OH) attached to the ethyl side chain, contributing to its solubility in polar solvents. The presence of a methyl group at the 5-position of the benzimidazole ring influences its chemical reactivity and potential biological activity. Typically, compounds of this class exhibit a range of pharmacological properties, including antimicrobial and antifungal activities, making them of interest in medicinal chemistry. The molecular structure allows for various interactions with biological targets, potentially leading to therapeutic applications. Additionally, the compound may exhibit moderate stability under standard conditions, although specific reactivity can vary based on environmental factors such as pH and temperature. Overall, 1H-Benzimidazole-2-ethanol, 5-methyl- is a versatile compound with potential applications in pharmaceuticals and biochemistry.

Formula: C₁₀H₁₂N₂O

InChI: InChI=1/C10H12N2O/c1-7-2-3-8-9(6-7)12-10(11-8)4-5-13/h2-3,6,13H,4-5H2,1H3,(H,11,12)

SMILES: Cc1ccc2c(c1)[nH]c(CCO)n2

Synonyms:

• 2-(6-methyl-1H-benzimidazol-2-yl)ethanol

2-(6-Methyl-1H-benzo[d]imidazol-2-yl)ethanol

CAS: 18046-41-8

Formula: C₁₀H₁₂N₂O

Molecular weight: 176.2151

Ref: IN-DA00ACWO

2-(6-methyl-1H-benzimidazol-2-yl)ethanol

CAS: 18046-41-8

Formula: C₁₀H₁₂N₂O

Purity: 95.0%

Molecular weight: 176.219

Ref: 10-F308963