CymitQuimica logo

CAS 180464-92-0

:

Bicyclo[1.1.1]pentane-1-carboxylic acid, 3-formyl-, methyl ester (9CI)

Description:
Bicyclo[1.1.1]pentane-1-carboxylic acid, 3-formyl-, methyl ester, with the CAS number 180464-92-0, is a bicyclic organic compound characterized by its unique structural framework, which consists of a bicyclo[1.1.1]pentane core. This compound features a carboxylic acid functional group and an aldehyde group, along with a methyl ester moiety, contributing to its reactivity and potential applications in organic synthesis. The bicyclic structure imparts rigidity and strain, influencing its chemical properties and reactivity. Typically, compounds of this nature exhibit interesting behavior in reactions such as esterification and condensation due to the presence of both the carboxylic acid and aldehyde functionalities. Additionally, the compound may display specific physical properties such as solubility in organic solvents and distinct melting and boiling points, which are influenced by its molecular structure. Its unique characteristics make it a subject of interest in synthetic organic chemistry and materials science, where it may serve as a building block for more complex molecules or materials.
Formula:C8H10O3
InChI:InChI=1S/C8H10O3/c1-11-6(10)8-2-7(3-8,4-8)5-9/h5H,2-4H2,1H3
InChI key:SWHCZCYZLWROJM-UHFFFAOYSA-N
SMILES:COC(=O)C12CC(C1)(C2)C=O
Found 4 products.