CAS 180468-42-2
:Ethyl (S)-1-phenyl-1,2,3,4-tetrahydro-2-isoquinolinecarboxylate
Description:
Ethyl (S)-1-phenyl-1,2,3,4-tetrahydro-2-isoquinolinecarboxylate is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline framework. This compound features a phenyl group and an ethyl ester functional group, contributing to its potential biological activity. The presence of the chiral center at the tetrahydroisoquinoline moiety indicates that it can exist in enantiomeric forms, with the (S) configuration being significant for its pharmacological properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of analgesics or other therapeutic agents. The molecular structure suggests that it may exhibit interactions with various biological targets, making it of interest in drug discovery. Additionally, the compound's solubility, stability, and reactivity can be influenced by the ester and aromatic functionalities, which are important for its behavior in biological systems and during synthesis. Overall, this compound represents a class of molecules that bridge organic chemistry and pharmacology.
Formula:C18H19NO2
InChI:InChI=1/C18H19NO2/c1-2-21-18(20)19-13-12-14-8-6-7-11-16(14)17(19)15-9-4-3-5-10-15/h3-11,17H,2,12-13H2,1H3
SMILES:CCOC(=O)N1CCc2ccccc2C1c1ccccc1
Synonyms:- (S)-3,4-Dihydro-1-phenyl-2(1H)-isoquinolinecarboxylic acid ethyl ester
- ethyl 1-phenyl-3,4-dihydroisoquinoline-2(1H)-carboxylate
- Ethyl (S)-1-phenyl-1,2,3,4-tetrahydro-2-isoquinoline carboxylate
- propyl (S)-1-phenyl-3,4-dihydroisoquinoline-2(1H)-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2(1H)-Isoquinolinecarboxylic acid, 3,4-dihydro-1-phenyl-, ethyl ester, (1S)-
CAS:Formula:C18H19NO2Purity:98%Color and Shape:SolidMolecular weight:281.3490Ethyl (S)-1-Phenyl-1,2,3,4-tetrahydro-2-isoquinolinecarboxylate
CAS:Impurity Solifinacin Ethyl Carbamate Impurity
Applications Solifenacin (S676700) intermediate.
References Ryo, N., et al.: J. Med. Chem., 48, 6597 (2005)Formula:C18H19NO2Color and Shape:Light YellowMolecular weight:281.35(S)-ethyl 1-phenyl-3,4-dihydroisoquinoline-2(1H)-carboxylate
CAS:Purity:98%Molecular weight:281.355011Ethyl (S)-1-phenyl-1,2,3,4-tetrahydro-2-isoquinolinecarboxylate
CAS:Ethyl (S)-1-phenyl-1,2,3,4-tetrahydro-2-isoquinolinecarboxylate is an analytical standard used to identify impurities in drug products. It is a metabolite of the drug product and has been shown to be safe for human consumption. The compound is a synthetic chemical that is not found naturally in the environment. CAS No. 180468-42-2
Formula:C18H19NO2Purity:Min. 95%Molecular weight:281.35 g/mol






