CAS 1805525-24-9

4-Chloro-2-fluoro-5-methylbenzenesulfonamide

Description:

4-Chloro-2-fluoro-5-methylbenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The compound features a benzene ring substituted with a chlorine atom at the para position, a fluorine atom at the ortho position, and a methyl group at the meta position relative to the sulfonamide group. This specific arrangement of substituents contributes to its unique chemical reactivity and potential biological activity. The presence of both halogens (chlorine and fluorine) can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the sulfonamide group imparts solubility in polar solvents, making it suitable for various applications in medicinal chemistry. The compound's molecular structure suggests potential use in pharmaceuticals, particularly in the development of antimicrobial agents. However, detailed studies on its pharmacological properties and toxicity would be necessary to fully understand its applications and safety profile.

Formula: C₇H₇ClFNO₂S

InChI: InChI=1S/C7H7ClFNO2S/c1-4-2-7(13(10,11)12)6(9)3-5(4)8/h2-3H,1H3,(H2,10,11,12)

InChI key: InChIKey=OVCIFPGKTSSQLH-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(F)C=C(Cl)C(C)=C1

Synonyms:

• Benzenesulfonamide, 4-chloro-2-fluoro-5-methyl-
• 4-Chloro-2-fluoro-5-methylbenzenesulfonamide

4-Chloro-2-fluoro-5-methylbenzenesulfonamide

CAS: 1805525-24-9

4-Chloro-2-fluoro-5-methylbenzenesulfonamide

Purity: ≥95%

Molecular weight: 223.65g/mol

Ref: 54-PC303330