CAS 1806-29-7: [1,1′-Biphenyl]-2,2′-diol
Description:[1,1′-Biphenyl]-2,2′-diol, also known as 2,2'-biphenol, is an organic compound characterized by the presence of two phenyl rings connected by a single bond, with hydroxyl (-OH) groups attached to the second carbon of each ring. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. Its molecular structure allows for the formation of hydrogen bonds, which can influence its physical properties and reactivity. [1,1′-Biphenyl]-2,2′-diol is often used in the synthesis of various chemical compounds, including pharmaceuticals and polymers, due to its ability to act as a building block in organic synthesis. Additionally, it exhibits antioxidant properties and can be involved in various chemical reactions, such as oxidation and substitution reactions. Safety data indicates that, while it may pose some health risks, proper handling and safety measures can mitigate these concerns in laboratory and industrial settings.
Formula:C12H10O2
InChI:InChI=1S/C12H10O2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8,13-14H
InChI key:InChIKey=IMHDGJOMLMDPJN-UHFFFAOYSA-N
SMILES:OC=1C=CC=CC1C=2C=CC=CC2O
- Synonyms:
- 1,1'-Bi-2-phenol
- 2,2'-Biphenyldiol
- 2,2'-Bisphenol
- 2,2'-Dihydroxy-1,1'-biphenyl
- 2,2-Dihydroxybiphenyl
- 2,2-Dihydroxydiphenyl
- 2-(2-Hydroxyphenyl)phenol
- 2′-Hydroxy-1,1′-biphenyl-2-ol
- Bifenilo-2,2'-Diol
- Biphenyl, 2,2'-Dihydroxy-
- See more synonyms
- Biphenyl-2,2-diol
- Biphenyle-2,2'-diol
- Nsc 37068
- [1,1'-Biphenyl]-2,2'-diol
- o,o'-Dihydroxybiphenyl
- o,o-Biphenol
- o,o-Diphenol
- 2,2-Biphenol
![[1,1′-Biphenyl]-2,2′-diol](https://static.cymitquimica.com/cas-image/94881-11-biphenyl-22-diol.png)
![[1,1'-Biphenyl]-2,2'-diol](https://static.cymitquimica.com/products/IN/thumb/DA002258.jpg)
![[1,1'-Biphenyl]-2,2'-diol](https://static.cymitquimica.com/products/10/thumb/F241052.jpg)
