CAS 18060-72-5

3-methylsulfanyl-2H-1,2,4-triazin-5-one

Description:

3-Methylsulfanyl-2H-1,2,4-triazin-5-one is a heterocyclic organic compound characterized by its triazine ring structure, which contains nitrogen atoms in addition to carbon. The presence of a methylsulfanyl group indicates that a methyl group is attached to a sulfur atom, contributing to the compound's unique properties. This compound typically exhibits moderate solubility in polar solvents due to its polar functional groups. It may display biological activity, making it of interest in pharmaceutical and agricultural applications. The triazine ring is known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 3-methylsulfanyl-2H-1,2,4-triazin-5-one represents a class of compounds with diverse applications in chemistry and related fields.

Formula: C₄H₅N₃OS

InChI: InChI=1/C4H5N3OS/c1-9-4-6-3(8)2-5-7-4/h2H,1H3,(H,6,7,8)

SMILES: CSc1nc(cnn1)O

Synonyms:

• 1,2,4-Triazin-5(2H)-one,3-(methylthio)-(9CI)
• 3-(methylsulfanyl)-1,2,4-triazin-5(2H)-one

1,2,4-Triazin-5(2H)-one, 3-(methylthio)-

CAS: 18060-72-5

Formula: C₄H₅N₃OS

Purity: 97%

Molecular weight: 143.1670

Ref: IN-DA00225U

3-(Methylthio)-1,2,4-triazin-5(2H)-one

CAS: 18060-72-5

3-(Methylthio)-1,2,4-triazin-5(2H)-one

Purity: ≥95%

Molecular weight: 143.17g/mol

Ref: 54-OR28167

3-(methylthio)-1,2,4-triazin-5(4H)-one

CAS: 18060-72-5

Formula: C₄H₅N₃OS

Purity: 97%

Molecular weight: 143.16

Ref: 10-F494697

3-(Methylthio)-1,2,4-triazin-5(4H)-one

CAS: 18060-72-5

3-(Methylthio)-1,2,4-triazin-5(4H)-one is an organic compound that belongs to the class of thiones. It is a ligand in coordination chemistry and can be used for the discovery of new lead compounds. 3-(Methylthio)-1,2,4-triazin-5(4H)-one binds to heavy metals such as lead or zinc by forming chelate complexes with them. This ligand also has nitro groups that are sensitive to oxidation and nitration under acidic conditions. The compound has been shown to have high chemical stability when exposed to air or moisture and heat. 3-(Methylthio)-1,2,4-triazin-5(4H)-one is not toxic when ingested orally and does not cause skin irritation or eye damage in animal studies.

Formula: C₄H₅N₃OS

Purity: Min. 95%

Molecular weight: 143.17 g/mol

Ref: 3D-TAA06072