CAS 180603-76-3
:3-[[4-[2-[1-[(2S,3R,4R,5R)-6-carboxy-3,4,5-trihydroxy-tetrahydropyran-2-yl]tetrazol-5-yl]phenyl]phenyl]methyl]-2-ethoxy-benzimidazole-4-carboxylic acid
Description:
The chemical substance with the name "3-[[4-[2-[1-[(2S,3R,4R,5R)-6-carboxy-3,4,5-trihydroxy-tetrahydropyran-2-yl]tetrazol-5-yl]phenyl]phenyl]methyl]-2-ethoxy-benzimidazole-4-carboxylic acid" and CAS number "180603-76-3" is a complex organic compound characterized by its multi-functional groups and structural intricacies. It features a benzimidazole core, which is known for its biological activity, and incorporates a tetrazole moiety, contributing to its potential pharmacological properties. The presence of multiple hydroxyl groups suggests it may exhibit strong hydrogen bonding capabilities, influencing its solubility and reactivity. Additionally, the carboxylic acid functional group indicates potential for acid-base interactions, which can affect its behavior in biological systems. The stereochemistry indicated by the (2S,3R,4R,5R) configuration of the tetrahydropyran ring suggests that the compound may have specific spatial arrangements that could be crucial for its biological activity. Overall, this compound's complex structure may lead to unique interactions in biological systems, making it of interest in medicinal chemistry and drug development.
Formula:C30H28N6O9
InChI:InChI=1/C30H28N6O9/c1-2-44-30-31-20-9-5-8-19(28(40)41)21(20)35(30)14-15-10-12-16(13-11-15)17-6-3-4-7-18(17)26-32-33-34-36(26)27-24(39)22(37)23(38)25(45-27)29(42)43/h3-13,22-25,27,37-39H,2,14H2,1H3,(H,40,41)(H,42,43)/t22-,23-,24-,25?,27+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
β-D-Glucopyranuronic acid, 1-[5-[4'-[(7-carboxy-2-ethoxy-1H-benzimidazol-1-yl)methyl][1,1'-biphenyl]-2-yl]-2H-tetrazol-2-yl]-1-deoxy-
CAS:Formula:C30H28N6O9Color and Shape:SolidMolecular weight:616.5781Candesartan N2-Glucuronide Ditriethylamine Salt
CAS:Formula:C30H28N6O9·2Et3NMolecular weight:616.59 2*101.19Candesartan N2-glucuronide
CAS:<p>Candesartan N-glucuronide is a metabolite of candesartan. It is produced by human UDP-glucuronosyltransferase, which belongs to the subfamily of uridine diphosphate (UDP)-glucuronosyltransferases. Candesartan N-glucuronide inhibits angiotensin II receptor type 1 (AT1) and has minimal effects on angiotensin II receptor type 2 (AT2). Candesartan N-glucuronide binds to the AT1 receptor and blocks its activation by angiotensin II. This binding inhibits the uptake of sodium ions into cells and causes an increase in potassium ion secretion, leading to vasodilation. Candesartan N-glucuronide also induces the expression of cytochrome P450 3A5, which results in increased metabolism of drugs such as paclitaxel.</p>Formula:C30H28N6O9Purity:Min. 95%Molecular weight:616.58 g/mol



