CymitQuimica logo

CAS 180622-24-6

:

Piperazine, 3-methyl-1-(4-methylphenyl)- (9CI)

Description:
Piperazine, 3-methyl-1-(4-methylphenyl)-, also known by its CAS number 180622-24-6, is a chemical compound that belongs to the piperazine class of compounds, which are characterized by a six-membered ring containing two nitrogen atoms. This specific derivative features a methyl group at the 3-position and a para-methylphenyl group at the 1-position of the piperazine ring. The presence of these substituents contributes to its unique chemical properties, including potential biological activity. Piperazine derivatives are often studied for their pharmacological applications, including their roles as anxiolytics, antidepressants, and in other therapeutic areas. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for various interactions, making it a subject of interest in medicinal chemistry and drug design. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H18N2
InChI:InChI=1S/C12H18N2/c1-10-3-5-12(6-4-10)14-8-7-13-11(2)9-14/h3-6,11,13H,7-9H2,1-2H3
InChI key:NUVOURRQFIQWTK-UHFFFAOYSA-N
SMILES:CC1CN(CCN1)C2=CC=C(C=C2)C
Found 1 products.