CymitQuimica logo

CAS 1806275-40-0

:

3,4-dichloro-2-nitroanisole

Description:
3,4-Dichloro-2-nitroanisole is an organic compound characterized by its aromatic structure, which includes a methoxy group, two chlorine atoms, and a nitro group. Its molecular formula is C8H7Cl2N O3, indicating the presence of chlorine and nitro functional groups that contribute to its chemical reactivity and properties. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro group suggests that it may participate in electrophilic substitution reactions, while the chlorine atoms can influence its reactivity and solubility in different solvents. Additionally, 3,4-dichloro-2-nitroanisole may exhibit specific biological activities, making it of interest in research and development. Safety data should be consulted, as compounds with halogenated and nitro groups can pose environmental and health risks. Proper handling and disposal procedures are essential when working with this substance.
Formula:C7H5Cl2NO3
InChI:InChI=1S/C7H5Cl2NO3/c1-13-5-3-2-4(8)6(9)7(5)10(11)12/h2-3H,1H3
InChI key:BHJTYLCUHUTYEE-UHFFFAOYSA-N
SMILES:COC1=C(C(=C(C=C1)Cl)Cl)[N+](=O)[O-]
Found 4 products.