CAS 1806353-47-8

1,2-Dichloro-5-(difluoromethoxy)-3-fluorobenzene

Description:

1,2-Dichloro-5-(difluoromethoxy)-3-fluorobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with multiple halogen atoms and a methoxy group. The presence of two chlorine atoms and one fluorine atom on the benzene ring contributes to its reactivity and potential applications in various chemical processes. The difluoromethoxy group enhances its polarity and may influence its solubility in organic solvents. This compound is likely to exhibit properties typical of halogenated aromatic compounds, such as increased stability and resistance to degradation. Its unique substitution pattern may also impart specific biological activity or utility in agrochemical or pharmaceutical applications. Safety considerations are important, as halogenated compounds can pose environmental and health risks, necessitating careful handling and disposal. Overall, 1,2-Dichloro-5-(difluoromethoxy)-3-fluorobenzene represents a complex chemical entity with potential significance in various fields of chemistry and material science.

Formula: C₇H₃Cl₂F₃O

InChI: InChI=1S/C7H3Cl2F3O/c8-4-1-3(13-7(11)12)2-5(10)6(4)9/h1-2,7H

InChI key: InChIKey=NHKJCGYVGMNMFM-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=CC(Cl)=C(Cl)C(F)=C1

Synonyms:

• 1,2-Dichloro-5-(difluoromethoxy)-3-fluorobenzene
• Benzene, 1,2-dichloro-5-(difluoromethoxy)-3-fluoro-