CAS 18065-78-6: 1-(2-phenylethyl)pyridin-2(1H)-one

Description:1-(2-phenylethyl)pyridin-2(1H)-one, also known as 2-pyridinone derivative, is an organic compound characterized by its pyridine ring and a phenylethyl substituent. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. It typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature, while being less soluble in water due to the hydrophobic phenyl group. The presence of the pyridine ring imparts basic properties, allowing it to participate in coordination chemistry and interact with metal ions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for potential interactions with biological targets, which could lead to pharmacological effects. Overall, 1-(2-phenylethyl)pyridin-2(1H)-one is a versatile compound with applications in organic synthesis and potential therapeutic uses, warranting further investigation into its properties and effects.

Formula:C₁₃H₁₃NO

InChI:InChI=1/C13H13NO/c15-13-8-4-5-10-14(13)11-9-12-6-2-1-3-7-12/h1-8,10H,9,11H2

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-(2-Phenylethyl)pyridin-2(1H)-one REF: 86-MM0528.22-0025CAS: 18065-78-6	- - -	To inquire	Mon 21 Apr 25
1-Phenethyl-2-pyridone REF: TR-P321315CAS: 18065-78-6	- - -	519.00 €~926.00 €	Mon 28 Apr 25
1-Phenethyl-2-pyridone-d5 REF: TR-P321317CAS: 18065-78-6	- - -	1,151.00 €	Tue 27 May 25
1-Phenethyl-2-pyridone-d5 REF: 3D-TAA06578CAS: 18065-78-6	Min. 95%	To inquire	Wed 28 May 25