CAS 18069-14-2

Polypodine B

Description:

Polypodine B is a naturally occurring alkaloid primarily derived from certain plant species, particularly those in the family of Asparagaceae. It is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. This compound exhibits a range of pharmacological properties, including potential anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry and pharmacology. Polypodine B has been studied for its interactions with various biological targets, which may lead to therapeutic applications. Additionally, its solubility and stability can vary depending on environmental conditions, influencing its bioavailability and efficacy. As with many alkaloids, the safety profile and potential toxicity of Polypodine B are important considerations in its application, necessitating further research to fully understand its effects and mechanisms of action. Overall, Polypodine B represents a significant area of study within natural product chemistry and its potential uses in healthcare.

Formula: C₂₇H₄₄O₈

InChI: InChI=1S/C27H44O8/c1-22(2,32)9-8-20(30)25(5,33)19-7-11-26(34)16-12-21(31)27(35)14-18(29)17(28)13-24(27,4)15(16)6-10-23(19,26)3/h12,15,17-20,28-30,32-35H,6-11,13-14H2,1-5H3/t15-,17-,18+,19-,20+,23+,24+,25+,26+,27+/m0/s1

InChI key: InChIKey=GMFLGNRCCFYOKL-ACCCYTKYSA-N

SMILES: O[C@]12C=3[C@@]([C@]4(C)[C@](O)(C(=O)C3)C[C@@H](O)[C@@H](O)C4)(CC[C@]1(C)[C@@]([C@@]([C@@H](CCC(C)(C)O)O)(C)O)(CC2)[H])[H]

Synonyms:

• 5β-Hydroxyecdysterone
• (2β,3β,5β,22R)-2,3,5,14,20,22,25-Heptahydroxycholest-7-en-6-one
• Polypodin B
• 5β-Cholest-7-en-6-one, 2β,3β,5,14,20,22,25-heptahydroxy-, (22R)-
• Cholest-7-en-6-one, 2,3,5,14,20,22,25-heptahydroxy-, (2β,3β,5β,22R)-

Polypodine B

CAS: 18069-14-2

Formula: C₂₇H₄₄O₈

Purity: Powder

Molecular weight: 496.6335

Ref: IN-DA00AQ4Z

Polypodine B

CAS: 18069-14-2

Polypodine B shows growth-promoting effects on in vitro development of the larval endoparasitoid, Venturia canescens (Hymenoptera: Ichneumonidae).

Formula: C₂₇H₄₄O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 496.641

Ref: TM-TN4816

Polypodine B

CAS: 18069-14-2

Polypodine B is a natural compound derived from the rhizomes of the plant Polypodium leucotomos, which is known for its antioxidant and anti-inflammatory properties. It is a secondary metabolite that plays a role in the plant's defense mechanisms. The compound acts by modulating various signaling pathways and inhibiting the production of reactive oxygen species, thereby reducing oxidative stress and subsequent cellular damage.

Formula: C₂₇H₄₄O₈

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 496.60 g/mol

Ref: 3D-TAA06914