CAS 180718-22-3

Imidazo[1,5-a]pyridine-7-carboxylic acid, 5,6,7,8-tetrahydro-, hydrochloride (1:1)

Description:

Imidazo[1,5-a]pyridine-7-carboxylic acid, 5,6,7,8-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused ring system that includes both imidazole and pyridine moieties. This compound typically exists as a hydrochloride salt, enhancing its solubility in aqueous solutions. The presence of the carboxylic acid functional group contributes to its acidic properties, while the tetrahydro configuration indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring structure. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various biological pathways. Its molecular interactions can be influenced by the presence of the hydrochloride, which can affect its pharmacokinetics and bioavailability. As with many heterocyclic compounds, it may also display unique reactivity patterns, making it a valuable subject for further chemical and biological studies.

Formula: C₈H₁₀N₂O₂·ClH

InChI: InChI=1S/C8H10N2O2.ClH/c11-8(12)6-1-2-10-5-9-4-7(10)3-6;/h4-6H,1-3H2,(H,11,12);1H

InChI key: InChIKey=HDBAQWHBJBIVSJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC=2N(CC1)C=NC2.Cl

Synonyms:

• Imidazo[1,5-a]pyridine-7-carboxylic acid, 5,6,7,8-tetrahydro-, hydrochloride (1:1)
• Imidazo[1,5-a]pyridine-7-carboxylic acid, 5,6,7,8-tetrahydro-, monohydrochloride

5H,6H,7H,8H-Imidazo[1,5-a]pyridine-7-carboxylic acid hydrochloride

CAS: 180718-22-3

Versatile small molecule scaffold

Formula: C₈H₁₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 202.64 g/mol

Ref: 3D-FHA71822