CAS 1807208-33-8

3-Bromo-4-(trifluoromethyl)-1,2-benzenediamine

Description:

3-Bromo-4-(trifluoromethyl)-1,2-benzenediamine is an organic compound characterized by its aromatic structure, which includes a bromine atom and a trifluoromethyl group attached to a benzene ring that also contains two amine functional groups. This compound is typically a solid at room temperature and exhibits properties common to aromatic amines, such as potential solubility in organic solvents and reactivity due to the presence of the amine groups. The bromine and trifluoromethyl substituents can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The trifluoromethyl group is known for imparting unique characteristics, such as increased lipophilicity and stability, which can enhance the compound's utility in pharmaceuticals and agrochemicals. Additionally, the presence of multiple functional groups suggests that this compound may participate in hydrogen bonding and other intermolecular interactions, affecting its physical properties and reactivity. Safety and handling precautions should be observed due to the potential toxicity associated with amines and halogenated compounds.

Formula: C₇H₆BrF₃N₂

InChI: InChI=1S/C7H6BrF3N2/c8-5-3(7(9,10)11)1-2-4(12)6(5)13/h1-2H,12-13H2

InChI key: InChIKey=JSJALZJBRUAOKB-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(Br)C(N)=C(N)C=C1

Synonyms:

• 3-Bromo-4-(trifluoromethyl)-1,2-benzenediamine
• 1,2-Benzenediamine, 3-bromo-4-(trifluoromethyl)-

3-Bromo-4-(trifluoromethyl)-1,2-benzenediamime

CAS: 1807208-33-8

3-Bromo-4-(trifluoromethyl)-1,2-benzenediamime

Purity: ≥95%

Molecular weight: 255.04g/mol

Ref: 54-PC501057