CAS 1807454-59-6

2-Methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]-1H-indazol-3-yl]-3-furancarboxamide

Description:

2-Methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]-1H-indazol-3-yl]-3-furancarboxamide is a synthetic organic compound characterized by its complex molecular structure, which includes a furan ring, an indazole moiety, and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of aromatic and fluorinated groups, which can influence its solubility and bioavailability. The trifluoromethyl group is known to enhance metabolic stability and can affect the compound's interaction with biological targets. Additionally, the presence of the furan and indazole rings may contribute to potential biological activity, making it of interest in pharmaceutical research. The compound's molecular weight, melting point, and specific reactivity would depend on its precise structural arrangement and functional groups. Overall, this compound's unique characteristics make it a subject of interest in medicinal chemistry and drug development.

Formula: C₂₁H₁₆F₃N₃O₂

InChI: InChI=1S/C21H16F3N3O2/c1-13-16(10-11-29-13)20(28)25-19-17-4-2-3-5-18(17)27(26-19)12-14-6-8-15(9-7-14)21(22,23)24/h2-11H,12H2,1H3,(H,25,26,28)

InChI key: InChIKey=XLLRLAABUFOJPC-UHFFFAOYSA-N

SMILES: N(C(=O)C1=C(C)OC=C1)C=2C=3C(N(CC4=CC=C(C(F)(F)F)C=C4)N2)=CC=CC3

Synonyms:

• 2-Methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]-1H-indazol-3-yl]-3-furancarboxamide
• 3-Furancarboxamide, 2-methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]-1H-indazol-3-yl]-

3-Furancarboxamide, 2-methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]-1H-indazol-3-yl]-

CAS: 1807454-59-6

Formula: C₂₁H₁₆F₃N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 399.3658

Ref: IN-DA01RRB9

NP-G2-044

CAS: 1807454-59-6

NP-G2-044

Purity: ≥98%

Molecular weight: 399.37g/mol

Ref: 54-BUP12249

NP-G2-044

CAS: 1807454-59-6

NP-G2-044 is an orally active fascin inhibitor, with an IC50 of ~2 μM. It blocks tumor metastasis and increases antitumor immune response.

Formula: C₂₁H₁₆F₃N₃O₂

Purity: 99.66%

Color and Shape: Solid

Molecular weight: 399.37

Ref: TM-T9107