CAS 1807505-26-5

13-Oxo-4,7,10,14-tetraoxapentadecanoic acid

Description:

13-Oxo-4,7,10,14-tetraoxapentadecanoic acid is a synthetic compound characterized by its unique structure, which includes multiple ether linkages and a carboxylic acid functional group. This compound features a long carbon chain, contributing to its potential applications in various fields, including materials science and pharmaceuticals. The presence of multiple oxygen atoms in the form of ether groups enhances its solubility in polar solvents and may impart specific reactivity, making it useful in chemical synthesis and modification processes. The oxo group (ketone) at the 13th carbon position can also influence its reactivity and interaction with other molecules. As a fatty acid derivative, it may exhibit properties typical of surfactants or emulsifiers, which can be beneficial in formulations. However, detailed studies on its biological activity, toxicity, and environmental impact are essential for understanding its practical applications and safety profile. Overall, 13-Oxo-4,7,10,14-tetraoxapentadecanoic acid represents a complex organic molecule with potential utility in various chemical and industrial applications.

Formula: C₁₁H₂₀O₇

InChI: InChI=1S/C11H20O7/c1-15-11(14)3-5-17-7-9-18-8-6-16-4-2-10(12)13/h2-9H2,1H3,(H,12,13)

InChI key: InChIKey=GIIORLLUIQECST-UHFFFAOYSA-N

SMILES: C(CCOCCOCCOCCC(O)=O)(OC)=O

Synonyms:

• 13-Oxo-4,7,10,14-tetraoxapentadecanoic acid
• 3-Oxo-2,6,9,12-tetraoxapentadecan-15-oic acid
• 4,7,10,14-Tetraoxapentadecanoic acid, 13-oxo-

Carboxy-PEG3-mono-methyl ester

CAS: 1807505-26-5

Formula: C₁₁H₂₀O₇

Purity: 98%

Color and Shape: Liquid

Molecular weight: 264.2723

Ref: IN-DA00I077

Acid-PEG3-mono-methyl ester

CAS: 1807505-26-5

Acid-PEG3-mono-methyl ester, an alkyl/ether-based PROTAC linker, facilitates the synthesis of PROTACs[1].

Formula: C₁₁H₂₀O₇

Color and Shape: Solid

Molecular weight: 264.27

Ref: TM-T14102

Acid-PEG3-mono-methyl ester

CAS: 1807505-26-5

Acid-PEG3-mono-methyl ester

Purity: 98%

Molecular weight: 264.27g/mol

Ref: 54-OR1034140

Acid-PEG3-mono-methyl ester

CAS: 1807505-26-5

Purity: 98%

Molecular weight: 264.12

Ref: 10-F554802

Acid-PEG3-mono-methyl ester

CAS: 1807505-26-5

Acid-PEG3-mono-methyl ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Acid-PEG3-mono-methyl ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₁H₂₀O₇

Purity: Min. 95%

Molecular weight: 264.27 g/mol

Ref: 3D-HXC50526