CAS 1807505-26-5
:13-Oxo-4,7,10,14-tetraoxapentadecanoic acid
Description:
13-Oxo-4,7,10,14-tetraoxapentadecanoic acid is a synthetic compound characterized by its unique structure, which includes multiple ether linkages and a carboxylic acid functional group. This compound features a long carbon chain, contributing to its potential applications in various fields, including materials science and pharmaceuticals. The presence of multiple oxygen atoms in the form of ether groups enhances its solubility in polar solvents and may impart specific reactivity, making it useful in chemical synthesis and modification processes. The oxo group (ketone) at the 13th carbon position can also influence its reactivity and interaction with other molecules. As a fatty acid derivative, it may exhibit properties typical of surfactants or emulsifiers, which can be beneficial in formulations. However, detailed studies on its biological activity, toxicity, and environmental impact are essential for understanding its practical applications and safety profile. Overall, 13-Oxo-4,7,10,14-tetraoxapentadecanoic acid represents a complex organic molecule with potential utility in various chemical and industrial applications.
Formula:C11H20O7
InChI:InChI=1S/C11H20O7/c1-15-11(14)3-5-17-7-9-18-8-6-16-4-2-10(12)13/h2-9H2,1H3,(H,12,13)
InChI key:InChIKey=GIIORLLUIQECST-UHFFFAOYSA-N
SMILES:C(CCOCCOCCOCCC(O)=O)(OC)=O
Synonyms:- 13-Oxo-4,7,10,14-tetraoxapentadecanoic acid
- 3-Oxo-2,6,9,12-tetraoxapentadecan-15-oic acid
- 4,7,10,14-Tetraoxapentadecanoic acid, 13-oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Carboxy-PEG3-mono-methyl ester
CAS:Formula:C11H20O7Purity:98%Color and Shape:LiquidMolecular weight:264.2723Acid-PEG3-mono-methyl ester
CAS:Acid-PEG3-mono-methyl ester, an alkyl/ether-based PROTAC linker, facilitates the synthesis of PROTACs[1].Formula:C11H20O7Color and Shape:SolidMolecular weight:264.27Acid-PEG3-mono-methyl ester
CAS:Acid-PEG3-mono-methyl ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Acid-PEG3-mono-methyl ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.
Formula:C11H20O7Purity:Min. 95%Molecular weight:264.27 g/molRef: 3D-HXC50526
Discontinued product




