CAS 1807512-36-2

3-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]-1-propanol

Description:

3-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]-1-propanol, identified by its CAS number 1807512-36-2, is a chemical compound characterized by its complex structure featuring multiple ethoxy groups and an azido functional group. The presence of the azido group (-N3) suggests potential reactivity, particularly in click chemistry applications, where it can participate in cycloaddition reactions. The compound's structure indicates it is likely to be a polar molecule due to the hydroxyl (-OH) group and the ether linkages, which can influence its solubility in various solvents. Additionally, the multiple ethoxy units may enhance its hydrophilicity, making it suitable for applications in bioconjugation or as a linker in synthetic chemistry. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, and it may exhibit specific biological activities or interactions due to its functional groups. Overall, this compound represents a versatile building block in organic synthesis and materials science.

Formula: C₉H₁₉N₃O₄

InChI: InChI=1S/C9H19N3O4/c10-12-11-2-5-15-7-9-16-8-6-14-4-1-3-13/h13H,1-9H2

InChI key: InChIKey=UUSDGPCVMBHTRJ-UHFFFAOYSA-N

SMILES: C(OCCOCCCO)COCCN=[N+]=[N-]

Synonyms:

• 1-Propanol, 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-
• 3-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]-1-propanol

Azido-PEG3-(CH2)3OH

CAS: 1807512-36-2

Formula: C₉H₁₉N₃O₄

Purity: 95%

Molecular weight: 233.2649

Ref: IN-DA00I07C

Azido-PEG3-C3-OH

CAS: 1807512-36-2

Azido-PEG3-C3-OH

Purity: 98%

Molecular weight: 233.26g/mol

Ref: 54-OR1001662

Azido-PEG3-C3-OH

CAS: 1807512-36-2

Azido-PEG3-C3-OH is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₉H₁₉N₃O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 233.26

Ref: TM-T14427

Azido-PEG3-(CH2)3OH

CAS: 1807512-36-2

Azido-PEG3-(CH2)3OH is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, azido-PEG3-(CH2)3OH is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.

Formula: C₉H₁₉N₃O₄

Purity: Min. 95%

Molecular weight: 233.27 g/mol

Ref: 3D-HXC51236