CAS 1807518-67-7

3-[(14-Bromo-13-oxo-3,6,9-trioxa-12-azatetradec-1-yl)oxy]propanoic acid

Description:

3-[(14-Bromo-13-oxo-3,6,9-trioxa-12-azatetradec-1-yl)oxy]propanoic acid is a complex organic compound characterized by its unique structure, which includes a long carbon chain, multiple functional groups, and a bromine atom. The presence of the bromo substituent indicates potential reactivity, particularly in nucleophilic substitution reactions. The oxo group suggests that the compound may exhibit ketone-like properties, while the azatetradecane backbone implies that it contains nitrogen, which can influence its solubility and reactivity. The propanoic acid moiety contributes acidic properties, allowing for potential interactions with bases or other nucleophiles. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and unique structural features. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it a candidate for further investigation in synthetic and applied chemistry contexts.

Formula: C₁₃H₂₄BrNO₇

InChI: InChI=1S/C13H24BrNO7/c14-11-12(16)15-2-4-20-6-8-22-10-9-21-7-5-19-3-1-13(17)18/h1-11H2,(H,15,16)(H,17,18)

InChI key: InChIKey=LMFYGPXSVUULRZ-UHFFFAOYSA-N

SMILES: C(NCCOCCOCCOCCOCCC(O)=O)(CBr)=O

Synonyms:

• 3-[(14-Bromo-13-oxo-3,6,9-trioxa-12-azatetradec-1-yl)oxy]propanoic acid
• 1-Bromo-2-oxo-6,9,12,15-tetraoxa-3-azaoctadecan-18-oic acid
• Propanoic acid, 3-[(14-bromo-13-oxo-3,6,9-trioxa-12-azatetradec-1-yl)oxy]-

Bromoacetamido-PEG4-Acid

CAS: 1807518-67-7

Bromoacetamido-PEG4-Acid

Purity: 97%

Molecular weight: 386.24g/mol

Ref: 54-BIPG1311

Bromoacetamido-PEG4-acid

CAS: 1807518-67-7

Bromoacetamido-PEG4-acid: a PEG-linked PROTAC and cleavable 4-unit PEG ADC linker.

Formula: C₁₃H₂₄BrNO₇

Color and Shape: Solid

Molecular weight: 386.24

Ref: TM-T14823

1-Bromo-2-oxo-6,9,12,15-tetraoxa-3-azaoctadecan-18-oic acid

CAS: 1807518-67-7

Purity: 95%

Color and Shape: Viscous Liquid

Molecular weight: 386.2390137

Ref: 10-F870307

Bromoacetamido-PEG4-acid

CAS: 1807518-67-7

Bromoacetamido-PEG4-acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Bromoacetamido-PEG4-acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₃H₂₄BrNO₇

Purity: Min. 95%

Molecular weight: 386.24 g/mol

Ref: 3D-HXC51867