
CAS 1807518-71-3
:2,5-Dioxo-1-pyrrolidinyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate
Description:
2,5-Dioxo-1-pyrrolidinyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate, identified by its CAS number 1807518-71-3, is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring and multiple ethoxy groups. This compound typically exhibits properties such as solubility in polar solvents due to the presence of hydroxyl and ether functionalities, which enhance its hydrophilicity. The dioxo functional groups contribute to its potential reactivity, making it a candidate for various chemical reactions, including esterification and amidation. Additionally, the presence of multiple ethoxy chains may influence its biological activity and pharmacokinetic properties, potentially enhancing its stability and bioavailability. Such compounds are often explored in medicinal chemistry for their potential therapeutic applications, particularly in drug design and development. Overall, the unique structural features of this compound suggest it may have interesting chemical and biological properties worthy of further investigation.
Formula:C13H21NO8
InChI:InChI=1S/C13H21NO8/c15-4-6-20-8-10-21-9-7-19-5-3-13(18)22-14-11(16)1-2-12(14)17/h15H,1-10H2
InChI key:InChIKey=KQGZCLFKXYOVGS-UHFFFAOYSA-N
SMILES:O(C(CCOCCOCCOCCO)=O)N1C(=O)CCC1=O
Synonyms:- 2,5-Dioxo-1-pyrrolidinyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate
- Propanoic acid, 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-, 2,5-dioxo-1-pyrrolidinyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Propanoic acid, 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-, 2,5-dioxo-1-pyrrolidinyl ester
CAS:Formula:C13H21NO8Molecular weight:319.3077Hydroxy-PEG3-NHS
CAS:Hydroxy-PEG3-NHS: a water-soluble PEG variant with NHS for labeling amines and a hydroxyl for further modification.Formula:C13H21NO8Color and Shape:SolidMolecular weight:319.31


