CAS 1807521-05-6

Propanoic acid, 3-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]-, 2,5-dioxo-1-pyrrolidinyl ester

Description:

Propanoic acid, 3-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]-, 2,5-dioxo-1-pyrrolidinyl ester, identified by its CAS number 1807521-05-6, is a complex organic compound characterized by its functional groups and structural features. This substance contains a propanoic acid moiety, which contributes to its acidity and potential reactivity. The presence of a fluorenylmethoxycarbonyl (Fmoc) group indicates its application in peptide synthesis, particularly in protecting amino groups during the formation of peptide bonds. The ethoxy and pyrrolidinyl ester components suggest that it may exhibit specific solubility and stability characteristics, making it suitable for various chemical reactions. Additionally, the dioxo functionality implies potential reactivity in condensation or cyclization reactions. Overall, this compound is likely to be of interest in medicinal chemistry and synthetic organic chemistry due to its structural complexity and the presence of multiple functional groups that can participate in further chemical transformations.

Formula: C₂₄H₂₄N₂O₇

InChI: InChI=1S/C24H24N2O7/c27-21-9-10-22(28)26(21)33-23(29)11-13-31-14-12-25-24(30)32-15-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,20H,9-15H2,(H,25,30)

InChI key: InChIKey=BGPXUJXGIVJFGP-UHFFFAOYSA-N

SMILES: C(OC(NCCOCCC(ON1C(=O)CCC1=O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• Propanoic acid, 3-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]-, 2,5-dioxo-1-pyrrolidinyl ester
• 2,5-Dioxopyrrolidin-1-yl 3-[2-([[(9H-fluoren-9-yl)methoxy]carbonyl]amino)ethoxy]propanoate

Fmoc-PEG1-NHS ester

CAS: 1807521-05-6

Formula: C₂₄H₂₄N₂O₇

Purity: 95%

Molecular weight: 452.4566

Ref: IN-DA00I080

Fmoc-PEG1-NHS ester

CAS: 1807521-05-6

Fmoc-PEG1-NHS ester

Purity: 98%

Molecular weight: 452.46g/mol

Ref: 54-BIPG1415

Fmoc-PEG1-CH2CH2-NHS ester

CAS: 1807521-05-6

Purity: 95%

Molecular weight: 452.463

Ref: 10-F986808

Fmoc-PEG1-NHS ester

CAS: 1807521-05-6

Fmoc-PEG1-NHS ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Fmoc-PEG1-NHS ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₂₄H₂₄N₂O₇

Purity: Min. 95%

Molecular weight: 452.5 g/mol

Ref: 3D-HXC52105

Fmoc-PEG1-CH2CH2-NHS ester

CAS: 1807521-05-6

Fmoc-PEG1-CH2CH2-NHS ester is a polyethylene glycol (PEG)-derived linker engineered for the synthesis of proteolysis-targeting chimeras (PROTACs) [1].

Formula: C₂₄H₂₄N₂O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 452.46

Ref: TM-T15327