CAS 1807530-06-8
:2,5-Dioxo-1-pyrrolidinyl 3-(2-azidoethoxy)propanoate
Description:
2,5-Dioxo-1-pyrrolidinyl 3-(2-azidoethoxy)propanoate is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an azidoethoxy group. This compound features two carbonyl (oxo) groups, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the azido group suggests that it may participate in click chemistry reactions, making it useful for bioconjugation and labeling studies. Additionally, the ester functional group in the propanoate moiety indicates that it may undergo hydrolysis under certain conditions, releasing the corresponding alcohol and acid. The compound's molecular structure allows for various interactions, including hydrogen bonding and dipole-dipole interactions, which can influence its solubility and stability in different solvents. Overall, 2,5-Dioxo-1-pyrrolidinyl 3-(2-azidoethoxy)propanoate is a versatile compound with potential applications in drug development and materials science, although specific properties such as melting point, boiling point, and solubility would require empirical determination.
Formula:C9H12N4O5
InChI:InChI=1S/C9H12N4O5/c10-12-11-4-6-17-5-3-9(16)18-13-7(14)1-2-8(13)15/h1-6H2
InChI key:InChIKey=MGKGKSFTIINDPY-UHFFFAOYSA-N
SMILES:O(C(CCOCCN=[N+]=[N-])=O)N1C(=O)CCC1=O
Synonyms:- Propanoic acid, 3-(2-azidoethoxy)-, 2,5-dioxo-1-pyrrolidinyl ester
- 2,5-Dioxo-1-pyrrolidinyl 3-(2-azidoethoxy)propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,5-Dioxo-1-pyrrolidinyl 3-(2-azidoethoxy)propanoate
CAS:Formula:C9H12N4O5Purity:98%Color and Shape:SolidMolecular weight:256.2154Azido-PEG1-NHS ester
CAS:Azido-PEG1-NHS ester is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C9H12N4O5Purity:98%Color and Shape:SolidMolecular weight:256.22Azido-PEG1-NHS ester
CAS:Azido-PEG1-NHS ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Azido-PEG1-NHS ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.
Formula:C9H12N4O5Purity:Min. 95%Molecular weight:256.22 g/molRef: 3D-HXC53006
Discontinued product



