CAS 1807530-07-9
:2,3,4,5,6-Pentafluorophenyl 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoate
Description:
2,3,4,5,6-Pentafluorophenyl 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoate is a complex organic compound characterized by its unique structure, which includes a pentafluorophenyl group and an azidoethoxy moiety. The presence of multiple fluorine atoms on the phenyl ring enhances the compound's lipophilicity and stability, making it potentially useful in various chemical applications, including medicinal chemistry and materials science. The azido group introduces a reactive site that can participate in click chemistry, allowing for further functionalization or conjugation with other molecules. This compound is likely to exhibit low solubility in water due to its hydrophobic characteristics, while its reactivity can be leveraged in synthetic pathways. Additionally, the ethoxy linkers provide flexibility in the molecular structure, which may influence its biological activity and interaction with other substances. Overall, this compound represents a versatile building block in organic synthesis and could have applications in drug development or as a precursor for more complex chemical entities.
Formula:C15H16F5N3O5
InChI:InChI=1S/C15H16F5N3O5/c16-10-11(17)13(19)15(14(20)12(10)18)28-9(24)1-3-25-5-7-27-8-6-26-4-2-22-23-21/h1-8H2
InChI key:InChIKey=ZBZNPFUVVAAJIK-UHFFFAOYSA-N
SMILES:O(C(CCOCCOCCOCCN=[N+]=[N-])=O)C1=C(F)C(F)=C(F)C(F)=C1F
Synonyms:- Propanoic acid, 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-, 2,3,4,5,6-pentafluorophenyl ester
- 2,3,4,5,6-Pentafluorophenyl 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoate
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Azido-PEG3-PFP ester
CAS:Azido-PEG3-PFP esterFormula:C15H16F5N3O5Purity:96%Molecular weight:413.296652,3,4,5,6-Pentafluorophenyl 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoate
CAS:Formula:C15H16F5N3O5Purity:95%Color and Shape:LiquidMolecular weight:413.2967N3-PEG3-C2-PFP ester
CAS:N3-PEG3-C2-PFP ester: a stable 3-unit PEG linker for making antibody-drug conjugates.Formula:C15H16F5N3O5Purity:98%Color and Shape:SolidMolecular weight:413.3Azido-peg3-pfp ester
CAS:Perfluorophenyl 3-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)propanoateFormula:C15H16F5N3O5Purity:96%Molecular weight:413.3Azido-PEG3-PFP ester
CAS:Azido-PEG3-PFP ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Azido-PEG3-PFP ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.Formula:C15H16F5N3O5Purity:Min. 95%Molecular weight:413.3 g/molRef: 3D-HXC53007
Discontinued product




