CAS 1807534-78-6

2,3,4,5,6-Pentafluorophenyl 3-[2-[2-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate

Description:

2,3,4,5,6-Pentafluorophenyl 3-[2-[2-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate, identified by its CAS number 1807534-78-6, is a complex organic compound characterized by its multi-functional structure. It features a pentafluorophenyl group, which imparts significant electronegativity and lipophilicity, enhancing its potential applications in pharmaceuticals and materials science. The presence of the pyrrolidine moiety suggests potential biological activity, possibly influencing its interaction with biological targets. The ethoxy linkages contribute to the compound's solubility and stability in various solvents. This compound is likely to exhibit unique chemical reactivity due to the fluorinated aromatic ring, which can affect its electronic properties and reactivity patterns. Additionally, the presence of multiple ether linkages may enhance its flexibility and steric properties. Overall, this compound's intricate structure suggests potential utility in drug development or as a reagent in organic synthesis, although specific applications would depend on further empirical studies and characterization.

Formula: C₁₉H₁₈F₅NO₇

InChI: InChI=1S/C19H18F5NO7/c20-14-15(21)17(23)19(18(24)16(14)22)32-13(28)3-5-29-7-9-31-10-8-30-6-4-25-11(26)1-2-12(25)27/h1-2H,3-10H2

InChI key: InChIKey=NTHCDRJWHPEQDJ-UHFFFAOYSA-N

SMILES: O(C(CCOCCOCCOCCN1C(=O)C=CC1=O)=O)C2=C(F)C(F)=C(F)C(F)=C2F

Synonyms:

• Propanoic acid, 3-[2-[2-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]ethoxy]ethoxy]-, 2,3,4,5,6-pentafluorophenyl ester
• 2,3,4,5,6-Pentafluorophenyl 3-[2-[2-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate

Mal-PEG3-PFP

CAS: 1807534-78-6

Formula: C₁₉H₁₈F₅NO₇

Purity: 98%

Molecular weight: 467.3407

Ref: IN-DA00I08E

Mal-PEG3-PFP ester

CAS: 1807534-78-6

Mal-PEG3-PFP ester is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₉H₁₈F₅NO₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 467.34

Ref: TM-T15988