CAS 1807534-82-2

2,5-Dioxo-1-pyrrolidinyl 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetate

Description:

2,5-Dioxo-1-pyrrolidinyl 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetate, identified by its CAS number 1807534-82-2, is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring and multiple ethoxy groups. The presence of the azido group suggests potential for reactivity, particularly in click chemistry applications, making it of interest in medicinal chemistry and materials science. The dioxo functionality indicates the presence of two carbonyl groups, which can influence the compound's reactivity and stability. This compound may exhibit solubility in polar solvents due to the ethoxy chains, while its overall molecular structure could impart specific biological activities or interactions. As with many synthetic compounds, its properties such as melting point, boiling point, and specific reactivity would need to be determined through experimental methods. Safety and handling precautions should be observed due to the azido group, which can be sensitive and potentially hazardous.

Formula: C₁₄H₂₂N₄O₈

InChI: InChI=1S/C14H22N4O8/c15-17-16-3-4-22-5-6-23-7-8-24-9-10-25-11-14(21)26-18-12(19)1-2-13(18)20/h1-11H2

InChI key: InChIKey=GXXUNGLWTNJERF-UHFFFAOYSA-N

SMILES: O(C(COCCOCCOCCOCCN=[N+]=[N-])=O)N1C(=O)CCC1=O

Synonyms:

• Acetic acid, 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-, 2,5-dioxo-1-pyrrolidinyl ester
• 2,5-Dioxo-1-pyrrolidinyl 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetate

Azido-peg4-ch2co2nhs

CAS: 1807534-82-2

Formula: C₁₄H₂₂N₄O₈

Purity: 97%

Color and Shape: Liquid

Molecular weight: 374.3465

Ref: IN-DA00I08I

Azido-PEG4-NHS-ester

CAS: 1807534-82-2

Azido-PEG4-NHS-ester

Purity: 96%

Molecular weight: 374.35g/mol

Ref: 54-OR1001751

Azido-PEG4-NHS-ester

CAS: 1807534-82-2

Azido-PEG4-NHS-ester is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₄H₂₂N₄O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 374.35

Ref: TM-T14451

Azido-PEG4-NHS-ester

CAS: 1807534-82-2

Purity: 96%

Molecular weight: 374.14

Ref: 10-F554718

Azido-PEG4-NHS-ester

CAS: 1807534-82-2

Azido-PEG4-NHS-ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Azido-PEG4-NHS-ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₄H₂₂N₄O₈

Purity: Min. 95%

Molecular weight: 374.35 g/mol

Ref: 3D-HXC53482