CAS 1807534-84-4

3-[2-[2-[(4-Formylbenzoyl)amino]ethoxy]ethoxy]propanoic acid

Description:

3-[2-[2-[(4-Formylbenzoyl)amino]ethoxy]ethoxy]propanoic acid, identified by its CAS number 1807534-84-4, is a synthetic organic compound characterized by its complex structure that includes an amino group, an aldehyde functional group, and multiple ethoxy linkages. This compound features a propanoic acid moiety, which contributes to its acidic properties, making it soluble in polar solvents. The presence of the formyl group indicates potential reactivity, particularly in condensation reactions. The ethoxy groups enhance the compound's hydrophilicity, potentially influencing its biological activity and solubility profile. Such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the structural features suggest potential applications in drug design, particularly in targeting specific biological pathways. As with many synthetic compounds, the stability, reactivity, and biological interactions would depend on the specific conditions under which they are studied, including pH, temperature, and the presence of other chemical species.

Formula: C₁₅H₁₉NO₆

InChI: InChI=1S/C15H19NO6/c17-11-12-1-3-13(4-2-12)15(20)16-6-8-22-10-9-21-7-5-14(18)19/h1-4,11H,5-10H2,(H,16,20)(H,18,19)

InChI key: InChIKey=SMXKUAVAORJSAL-UHFFFAOYSA-N

SMILES: C(NCCOCCOCCC(O)=O)(=O)C1=CC=C(C=O)C=C1

Synonyms:

• Propanoic acid, 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]-
• 3-[2-[2-[(4-Formylbenzoyl)amino]ethoxy]ethoxy]propanoic acid

Ald-Ph-amido-PEG2-C2-acid

CAS: 1807534-84-4

Ald-Ph-amido-PEG2-C2-acid is a PEG-based PROTAC linker utilized for synthesizing PROTACs[1].

Formula: C₁₅H₁₉NO₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 309.31

Ref: TM-T14171

Ald--Ph-PEG2-acid

CAS: 1807534-84-4

Ald--Ph-PEG2-acid

Molecular weight: 309.31g/mol

Ref: 54-BIPG1016

Ald-pH-PEG2-acid

CAS: 1807534-84-4

Ald-pH-PEG2-acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Ald-pH-PEG2-acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₅H₁₉NO₆

Purity: Min. 95%

Molecular weight: 309.31 g/mol

Ref: 3D-HXC53484