CAS 1807534-84-4: 3-[2-[2-[(4-Formylbenzoyl)amino]ethoxy]ethoxy]propanoic acid

Description:3-[2-[2-[(4-Formylbenzoyl)amino]ethoxy]ethoxy]propanoic acid, identified by its CAS number 1807534-84-4, is a synthetic organic compound characterized by its complex structure that includes an amino group, an aldehyde functional group, and multiple ethoxy linkages. This compound features a propanoic acid moiety, which contributes to its acidic properties, making it soluble in polar solvents. The presence of the formyl group indicates potential reactivity, particularly in condensation reactions. The ethoxy groups enhance the compound's hydrophilicity, potentially influencing its biological activity and solubility profile. Such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the structural features suggest potential applications in drug design, particularly in targeting specific biological pathways. As with many synthetic compounds, the stability, reactivity, and biological interactions would depend on the specific conditions under which they are studied, including pH, temperature, and the presence of other chemical species.

Formula:C₁₅H₁₉NO₆

InChI:InChI=1S/C15H19NO6/c17-11-12-1-3-13(4-2-12)15(20)16-6-8-22-10-9-21-7-5-14(18)19/h1-4,11H,5-10H2,(H,16,20)(H,18,19)

InChI key:InChIKey=SMXKUAVAORJSAL-UHFFFAOYSA-N

SMILES:O=CC1=CC=C(C=C1)C(=O)NCCOCCOCCC(=O)O

Synonyms:
Propanoic acid, 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]-
3-[2-[2-[(4-Formylbenzoyl)amino]ethoxy]ethoxy]propanoic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Ald-Ph-amido-PEG2-C2-acid REF: TM-T14171CAS: 1807534-84-4	98%	To inquire	Tue 08 Apr 25
Ald--Ph-PEG2-acid REF: 54-BIPG1016CAS: 1807534-84-4	- - -	To inquire	Mon 14 Apr 25
Ald-pH-PEG2-acid REF: 3D-HXC53484CAS: 1807534-84-4	Min. 95%	To inquire	Mon 19 May 25