CAS 1807537-33-2
:1,1-Dimethylethyl 15-bromo-14-oxo-4,7,10-trioxa-13-azapentadecanoate
Description:
1,1-Dimethylethyl 15-bromo-14-oxo-4,7,10-trioxa-13-azapentadecanoate, identified by its CAS number 1807537-33-2, is a synthetic organic compound that features a complex structure characterized by the presence of a bromo substituent, an oxo group, and multiple ether linkages. The compound contains a long carbon chain, which contributes to its hydrophobic characteristics, while the presence of oxygen and nitrogen atoms introduces polar functional groups that can engage in hydrogen bonding. This dual nature may influence its solubility in various solvents, potentially making it soluble in organic solvents while being less soluble in water. The presence of the dimethyl group suggests steric hindrance, which may affect its reactivity and interactions with biological systems. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Understanding its chemical behavior, stability, and reactivity is crucial for exploring its practical applications in various fields.
Formula:C15H28BrNO6
InChI:InChI=1S/C15H28BrNO6/c1-15(2,3)23-14(19)4-6-20-8-10-22-11-9-21-7-5-17-13(18)12-16/h4-12H2,1-3H3,(H,17,18)
InChI key:InChIKey=QAQLZWBWKHLATI-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCNC(CBr)=O)CC(OC(C)(C)C)=O
Synonyms:- 4,7,10-Trioxa-13-azapentadecanoic acid, 15-bromo-14-oxo-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 15-bromo-14-oxo-4,7,10-trioxa-13-azapentadecanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Bromoacetamido-PEG3-t-butyl ester
CAS:Formula:C15H28BrNO6Purity:95%Color and Shape:SolidMolecular weight:398.2899Bromoacetamido-PEG3-t-Butyl Ester
CAS:Bromoacetamido-PEG3-t-Butyl EsterPurity:95%Molecular weight:398.29g/molBromoacetamido-PEG3-C2-Boc
CAS:Bromoacetamido-PEG3-C2-Boc is a polyethylene glycol (PEG) derived linker that is suitable for the synthesis of proteolysis-targeting chimeras (PROTACs) [1].Formula:C15H28BrNO6Color and Shape:SolidMolecular weight:398.29tert-Butyl 1-bromo-2-oxo-6,9,12-trioxa-3-azapentadecan-15-oate
CAS:Purity:97%Molecular weight:398.2940063Bromoacetamido-PEG3-t-butyl ester
CAS:Bromoacetamido-PEG3-t-butyl ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Bromoacetamido-PEG3-t-butyl ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.Formula:C15H28BrNO6Purity:Min. 95%Molecular weight:398.29 g/mol




