CAS 1807539-08-7

3,6,9,12-Tetraoxatetradecanesulfonic acid

Description:

3,6,9,12-Tetraoxatetradecanesulfonic acid is a synthetic chemical compound characterized by its unique structure, which includes a long carbon chain with multiple ether linkages and a sulfonic acid functional group. This compound is part of a class of polyether sulfonic acids, which are known for their surfactant properties and potential applications in various fields, including pharmaceuticals, detergents, and materials science. The presence of multiple ether groups contributes to its hydrophilicity, making it soluble in water and suitable for use in aqueous formulations. The sulfonic acid group enhances its ionic character, which can improve its interaction with other charged species in solution. Additionally, the compound's structure may confer stability and resistance to degradation under certain conditions. Overall, 3,6,9,12-Tetraoxatetradecanesulfonic acid is notable for its potential utility in applications requiring surfactants or stabilizers, although specific applications would depend on further research and development.

Formula: C₁₀H₂₂O₁₀S₂

InChI: InChI=1S/C10H22O10S2/c11-21(12,13)9-7-19-5-3-17-1-2-18-4-6-20-8-10-22(14,15)16/h1-10H2,(H,11,12,13)(H,14,15,16)

InChI key: InChIKey=URCFPXZEPHPAIR-UHFFFAOYSA-N

SMILES: C(S(=O)(=O)O)COCCOCCOCCOCCS(=O)(=O)O

Synonyms:

• 3,6,9,12-Tetraoxatetradecanesulfonic acid
• 2-[2-[2-[2-(2-sulfoethoxy)ethoxy]ethoxy]ethoxy]ethanesulfonic acid
• Bis-PEG4-sulfonic acid

Bis-PEG4-sulfonic acid

CAS: 1807539-08-7

Formula: C₁₀H₂₂O₁₀S₂

Purity: 98%

Molecular weight: 366.4057

Ref: IN-DA00I096

Bis-PEG4-sulfonic acid

CAS: 1807539-08-7

Bis-PEG4-sulfonic acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₀H₂₂O₁₀S₂

Color and Shape: Solid

Molecular weight: 366.41

Ref: TM-T14641

Bis-PEG4-sulfonic acid

CAS: 1807539-08-7

Bis-PEG4-sulfonic acid

Purity: 98%

Ref: 54-OR1040245

Bis-PEG4-sulfonic acid

CAS: 1807539-08-7

Purity: 98%

Molecular weight: 366.4

Ref: 10-F986512

Bis-PEG4-sulfonic acid

CAS: 1807539-08-7

Bis-PEG4-sulfonic acid is a PEG polymer categorised as homobifunctional PEG (X-PEG X). Used as a linker, bis-PEG4-sulfonic acid is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.

Formula: C₁₀H₂₂O₁₀S₂

Purity: Min. 95%

Molecular weight: 366.4 g/mol

Ref: 3D-HXC53908