CymitQuimica logo

CAS 1807539-09-8

:

2-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]ethyl 2-propenoate

Description:
2-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]ethyl 2-propenoate is a chemical compound characterized by its complex structure, which includes multiple ethoxy groups and an azido functional group. The presence of the azido group (-N3) indicates potential for reactivity, particularly in click chemistry applications, where it can participate in cycloaddition reactions. The propenoate moiety suggests that the compound can undergo polymerization, making it useful in the synthesis of polymers or as a monomer in various applications. The ethoxy groups contribute to the compound's solubility in organic solvents and may influence its physical properties, such as boiling point and viscosity. Additionally, the overall structure suggests that it may exhibit interesting biological or chemical properties, making it a candidate for further research in fields such as materials science or medicinal chemistry. Safety and handling precautions should be observed due to the presence of the azido group, which can be sensitive and potentially hazardous under certain conditions.
Formula:C11H19N3O5
InChI:InChI=1S/C11H19N3O5/c1-2-11(15)19-10-9-18-8-7-17-6-5-16-4-3-13-14-12/h2H,1,3-10H2
InChI key:InChIKey=AKEGJOJDWYDGEP-UHFFFAOYSA-N
SMILES:O(CCOCCOCCN=[N+]=[N-])CCOC(C=C)=O
Synonyms:
  • 2-Propenoic acid, 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl ester
  • 2-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]ethyl 2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.