CAS 1807539-10-1

4,7,14,17-Tetraoxa-10,11-dithiaeicosanedioic acid

Description:

4,7,14,17-Tetraoxa-10,11-dithiaeicosanedioic acid is a complex organic compound characterized by its unique structure, which includes multiple ether (–O–) and thioether (–S–) functional groups. This compound features a long carbon chain, specifically an eicosanedioic acid backbone, which contributes to its potential applications in various fields, including materials science and biochemistry. The presence of both oxygen and sulfur atoms in its structure suggests that it may exhibit interesting chemical reactivity and solubility properties, potentially making it useful as a surfactant or in the synthesis of polymers. Additionally, the arrangement of functional groups may influence its biological activity, making it a candidate for further research in medicinal chemistry. The compound's molecular weight, melting point, and solubility characteristics would be essential for practical applications and would typically be determined through experimental methods. Overall, 4,7,14,17-Tetraoxa-10,11-dithiaeicosanedioic acid represents a fascinating subject for study due to its structural complexity and potential utility in various chemical applications.

Formula: C₁₄H₂₆O₈S₂

InChI: InChI=1S/C14H26O8S2/c15-13(16)1-3-19-5-7-21-9-11-23-24-12-10-22-8-6-20-4-2-14(17)18/h1-12H2,(H,15,16)(H,17,18)

InChI key: InChIKey=TZKZHEPGHNBGKD-UHFFFAOYSA-N

SMILES: C(CC(O)=O)OCCOCCSSCCOCCOCCC(O)=O

Synonyms:

• 4,7,14,17-Tetraoxa-10,11-dithiaeicosanedioic acid

Acid-PEG2-SS-PEG2-acid

CAS: 1807539-10-1

Formula: C₁₄H₂₆O₈S₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 386.4814

Ref: IN-DA00I098

Acid-PEG2-SS-PEG2-Acid

CAS: 1807539-10-1

Acid-PEG2-SS-PEG2-Acid

Purity: 95%

Molecular weight: 386.48g/mol

Ref: 54-BIPG1004

Acid-PEG2-SS-PEG2-acid

CAS: 1807539-10-1

Acid-PEG2-SS-PEG2-acid is a 4-unit PEG ADC linker that employs cleavable bonds. It is utilized in the synthesis of antibody-drug conjugates (ADCs)[1].

Formula: C₁₄H₂₆O₈S₂

Color and Shape: Solid

Molecular weight: 386.48

Ref: TM-T14100

4,7,14,17-Tetraoxa-10,11-dithiaicosanedioic acid

CAS: 1807539-10-1

Purity: 95%

Molecular weight: 386.4700012

Ref: 10-F867314

Acid-PEG2-SS-PEG2-acid

CAS: 1807539-10-1

Acid-PEG2-SS-PEG2-acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Acid-PEG2-SS-PEG2-acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₄H₂₆O₈S₂

Purity: Min. 95%

Molecular weight: 386.5 g/mol

Ref: 3D-HXC53910