CAS 18076-61-4
:1H-benzotriazol-4-amine
Description:
1H-benzotriazol-4-amine, with the CAS number 18076-61-4, is an organic compound characterized by its benzotriazole structure, which consists of a fused benzene and triazole ring. This compound typically appears as a white to light yellow solid and is known for its solubility in polar solvents such as water and alcohols. It exhibits properties that make it useful in various applications, including as a corrosion inhibitor, UV stabilizer, and in the synthesis of dyes and pharmaceuticals. The presence of the amine group contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, 1H-benzotriazol-4-amine can form complexes with metals, enhancing its utility in materials science and catalysis. Safety data indicates that it should be handled with care, as it may pose risks if ingested or inhaled. Overall, its unique chemical structure and properties make it a valuable compound in both industrial and research settings.
Formula:C6H6N4
InChI:InChI=1/C6H6N4/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3H,7H2,(H,8,9,10)
InChI key:InChIKey=ZDWPBMJZDNXTPG-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC=C1)N=NN2
Synonyms:- 1H-Benzotriazol-4-amine
- 1H-Benzotriazol-7-amine
- 1H-Benzotriazole, 4-amino-
- 4-Aminobenzotriazole
- Benzotriazole, 4-amino-
- 1H-1,2,3-benzotriazol-4-amine hydrochloride
- 2H-Benzotriazol-4-ylamine
- 1H-benzo[d][1,2,3]triazol-4-amine hydrochloride
- 2H-benzotriazol-4-amine
- 1H-1,2,3-benzotriazol-4-amine(SALTDATA: HCl 0.4H2O)
- Einecs 241-982-2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1H-1,2,3-Benzotriazol-4-amine hydrochloride
CAS:Formula:C6H6N4Color and Shape:SolidMolecular weight:134.13861H-1,2,3-Benzotriazol-4-amine hydrochloride
CAS:Formula:C6H7ClN4Purity:95.0%Color and Shape:Solid, Beige powderMolecular weight:170.61H-1,2,3-Benzotriazol-4-amine
CAS:<p>1H-1,2,3-Benzotriazol-4-amine is a hydroxylated compound that belongs to the group of benzotriazole derivatives. It has been shown to inhibit the growth of cells in culture by binding to the nitrogen atoms in glutamate and inhibiting the production of nitric oxide synthase. 1H-1,2,3-Benzotriazol-4-amine also has binding constants for certain growth regulators that are 10 times higher than for other benzotriazoles. In vitro assays have shown that 1H-1,2,3-benzotriazol-4-amine is a potent corrosion inhibitor with an optical purity greater than 98%. The molecule was modeled using molecular modeling software and found to be stable when exposed to light. The molecule has also been tested on Sprague Dawley rats and found not to cause skin reactions.</p>Formula:C6H6N4Purity:Min. 95%Molecular weight:134.14 g/mol


