CymitQuimica logo

CAS 1807632-95-6

:

D-Glucitol,1,5-anhydro-1-C-[4-bromo-3-[(4-ethoxyphenyl)methyl]phenyl]-,(1S)-

Description:
D-Glucitol, 1,5-anhydro-1-C-[4-bromo-3-[(4-ethoxyphenyl)methyl]phenyl]-, (1S)- is a chemical compound characterized by its complex structure, which includes a glucitol backbone modified with a brominated phenyl group and an ethoxy-substituted phenyl moiety. This compound is likely to exhibit properties typical of sugar alcohols, such as being hygroscopic and having a sweet taste, while the presence of the brominated and ethoxy groups may impart unique reactivity and solubility characteristics. The bromine atom can enhance the compound's electrophilicity, making it potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the ethoxy group may influence the compound's lipophilicity and biological activity. As a result, this compound could have applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a synthetic intermediate. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise characterization.
Formula:C21H25BrO6
InChI:InChI=1S/C21H25BrO6/c1-2-27-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)21-20(26)19(25)18(24)17(11-23)28-21/h3-8,10,17-21,23-26H,2,9,11H2,1H3/t17-,18-,19+,20-,21+/m1/s1
InChI key:UABOQFANGSVXKK-ADAARDCZSA-N
SMILES:CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)Br
Found 12 products.