CAS 1807885-10-4

5-Bromo-N-[(1S)-1-phenylethyl]-2-pyridinamine

Description:

5-Bromo-N-[(1S)-1-phenylethyl]-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a bromine atom, a pyridine ring, and an amine functional group. The presence of the bromine substituent enhances its reactivity and can influence its biological activity. The compound features a chiral center at the phenylethyl group, which contributes to its stereochemistry and may affect its interaction with biological targets. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Additionally, the pyridine ring can participate in π-π stacking interactions and may contribute to the compound's solubility and stability in various solvents. Due to its structural characteristics, 5-Bromo-N-[(1S)-1-phenylethyl]-2-pyridinamine may have potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods.

Formula: C₁₃H₁₃BrN₂

InChI: InChI=1S/C13H13BrN2/c1-10(11-5-3-2-4-6-11)16-13-8-7-12(14)9-15-13/h2-10H,1H3,(H,15,16)/t10-/m0/s1

InChI key: InChIKey=RXWGKSYYHCZAJQ-JTQLQIEISA-N

SMILES: [C@H](NC1=CC=C(Br)C=N1)(C)C2=CC=CC=C2

Synonyms:

• 5-Bromo-N-[(1S)-1-phenylethyl]-2-pyridinamine
• 2-Pyridinamine, 5-bromo-N-[(1S)-1-phenylethyl]-

5-Bromo-N-[(1S)-1-phenylethyl]pyridin-2-amine

CAS: 1807885-10-4

Versatile small molecule scaffold

Formula: C₁₃H₁₃BrN₂

Purity: Min. 95%

Molecular weight: 277.16 g/mol

Ref: 3D-HXC88510